C34H41Cl2N5O4 — CID 68675131
1-ethyl-3,3,5-trimethyl-7-[3-[[3-(2-oxoquinolin-1-yl)-1-pyridin-4-ylpropyl]amino]propoxy]-1,5-benzodiazepine-2,4-dione;dihydrochloride (PubChem CID 68675131) has the molecular formula C34H41Cl2N5O4 and a molecular weight of 654.64 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[3-[[3-(2-oxoquinolin-1-yl)-1-pyridin-4-ylpropyl]amino]propoxy]-1,5-benzodiazepine-2,4-dione;dihydrochloride.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[3-[[3-(2-oxoquinolin-1-yl)-1-pyridin-4-ylpropyl]amino]propoxy]-1,5-benzodiazepine-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 68675131 |
| Molecular Formula | C34H41Cl2N5O4 |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 653.25 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[3-[[3-(2-oxoquinolin-1-yl)-1-pyridin-4-ylpropyl]amino]propoxy]-1,5-benzodiazepine-2,4-dione;dihydrochloride |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCNC(CCn3c(=O)ccc4ccccc43)c3ccncc3)ccc21.Cl.Cl |
| InChI | InChI=1S/C34H39N5O4.2ClH/c1-5-38-29-13-12-26(23-30(29)37(4)32(41)34(2,3)33(38)42)43-22-8-18-36-27(24-15-19-35-20-16-24)17-21-39-28-10-7-6-9-25(28)11-14-31(39)40;;/h6-7,9-16,19-20,23,27,36H,5,8,17-18,21-22H2,1-4H3;2*1H |
| InChIKey | NTFZMJUZTBXGQY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|