C9H12N4O — CID 68675530
2-butyl-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 68675530) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-butyl-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-butyl-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 68675530 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-butyl-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | CCCCn1nc2cnccn2c1=O |
| InChI | InChI=1S/C9H12N4O/c1-2-3-5-13-9(14)12-6-4-10-7-8(12)11-13/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | WMMJWQNZNCLJAQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |