About 2-methylporphyrin
2-methylporphyrin (PubChem CID 68675536) has the molecular formula C21H14N4
and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-methylporphyrin.
Molecular Properties
| Compound Name | 2-methylporphyrin |
| PubChem CID | 68675536 |
| Molecular Formula | C21H14N4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-methylporphyrin |
| SMILES | CC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C21H14N4/c1-13-8-20-11-18-5-4-16(23-18)9-14-2-3-15(22-14)10-17-6-7-19(24-17)12-21(13)25-20/h2-12H,1H3/b14-9-,15-10-,16-9-,17-10-,18-11-,19-12-,20-11-,21-12- |
| InChIKey | BHGCXCXNKOZNOP-OLOLARHWSA-N |
| XLogP | 3.97 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylporphyrin?
The IUPAC name of 2-methylporphyrin (CID 68675536) is 2-methylporphyrin.
What is the SMILES notation for 2-methylporphyrin?
The canonical SMILES for 2-methylporphyrin is CC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of 2-methylporphyrin?
The InChIKey is BHGCXCXNKOZNOP-OLOLARHWSA-N. The full InChI is InChI=1S/C21H14N4/c1-13-8-20-11-18-5-4-16(23-18)9-14-2-3-15(22-14)10-17-6-7-19(24-17)12-21(13)25-20/h2-12H,1H3/b14-9-,15-10-,16-9-,17-10-,18-11-,19-12-,20-11-,21-12-.
What are the key properties of 2-methylporphyrin?
2-methylporphyrin has a molecular weight of 322.37 g/mol, XLogP of 3.97, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylporphyrin is sourced from PubChem (CID 68675536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).