C25H22ClN5OS — CID 6867555
2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-phenylphenyl)methylideneamino]acetamide (PubChem CID 6867555) has the molecular formula C25H22ClN5OS and a molecular weight of 476.01 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-phenylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-phenylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6867555 |
| Molecular Formula | C25H22ClN5OS |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-phenylphenyl)methylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)N/N=C/c2ccc(-c3ccccc3)cc2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClN5OS/c1-2-31-24(21-12-14-22(26)15-13-21)29-30-25(31)33-17-23(32)28-27-16-18-8-10-20(11-9-18)19-6-4-3-5-7-19/h3-16H,2,17H2,1H3,(H,28,32)/b27-16+ |
| InChIKey | QGWTYPUZTJEXJA-JVWAILMASA-N |
| XLogP | 5.53 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|