About 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin
13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin (PubChem CID 68675656) has the molecular formula C27H21N5
and a molecular weight of 415.50 g/mol. Its IUPAC name is 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin |
| PubChem CID | 68675656 |
| Molecular Formula | C27H21N5 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin |
| SMILES | CCC1=C(c2ccccn2)c2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3 |
| InChI | InChI=1S/C27H21N5/c1-2-23-25-15-21-10-8-19(30-21)13-17-6-7-18(29-17)14-20-9-11-22(31-20)16-26(32-25)27(23)24-5-3-4-12-28-24/h3-16,29,31H,2H2,1H3/b17-13-,18-14-,19-13-,20-14-,21-15-,22-16-,25-15-,26-16- |
| InChIKey | DWOPKKQEKSEPQO-DBJFDTQISA-N |
| XLogP | 6.25 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin?
The IUPAC name of 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin (CID 68675656) is 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin.
What is the SMILES notation for 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin?
The canonical SMILES for 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin is CCC1=C(c2ccccn2)c2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.
What is the InChIKey of 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin?
The InChIKey is DWOPKKQEKSEPQO-DBJFDTQISA-N. The full InChI is InChI=1S/C27H21N5/c1-2-23-25-15-21-10-8-19(30-21)13-17-6-7-18(29-17)14-20-9-11-22(31-20)16-26(32-25)27(23)24-5-3-4-12-28-24/h3-16,29,31H,2H2,1H3/b17-13-,18-14-,19-13-,20-14-,21-15-,22-16-,25-15-,26-16-.
What are the key properties of 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin?
13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin has a molecular weight of 415.50 g/mol, XLogP of 6.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 13-ethyl-12-pyridin-2-yl-21,22-dihydroporphyrin is sourced from PubChem (CID 68675656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).