About 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride
3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride (PubChem CID 68675770) has the molecular formula C16H24ClNO
and a molecular weight of 281.83 g/mol. Its IUPAC name is 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride.
Molecular Properties
| Compound Name | 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride |
| PubChem CID | 68675770 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride |
| SMILES | Cc1cccc(C)c1COC1CC2CCC(C1)N2.Cl |
| InChI | InChI=1S/C16H23NO.ClH/c1-11-4-3-5-12(2)16(11)10-18-15-8-13-6-7-14(9-15)17-13;/h3-5,13-15,17H,6-10H2,1-2H3;1H |
| InChIKey | MVSBVKLVRZYIPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride?
The IUPAC name of 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride (CID 68675770) is 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride.
What is the SMILES notation for 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride?
The canonical SMILES for 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride is Cc1cccc(C)c1COC1CC2CCC(C1)N2.Cl.
What is the InChIKey of 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride?
The InChIKey is MVSBVKLVRZYIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO.ClH/c1-11-4-3-5-12(2)16(11)10-18-15-8-13-6-7-14(9-15)17-13;/h3-5,13-15,17H,6-10H2,1-2H3;1H.
What are the key properties of 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride?
3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride has a molecular weight of 281.83 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dimethylphenyl)methoxy]-8-azabicyclo[3.2.1]octane;hydrochloride is sourced from PubChem (CID 68675770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).