About methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate
methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate (PubChem CID 68676394) has the molecular formula C21H17F3N2O5S
and a molecular weight of 466.44 g/mol. Its IUPAC name is methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate.
Molecular Properties
| Compound Name | methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate |
| PubChem CID | 68676394 |
| Molecular Formula | C21H17F3N2O5S |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate |
| SMILES | COC(=O)CCC#Cc1cc(C(F)(F)F)ccc1NS(=O)(=O)c1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C21H17F3N2O5S/c1-13-25-18-10-8-16(12-19(18)31-13)32(28,29)26-17-9-7-15(21(22,23)24)11-14(17)5-3-4-6-20(27)30-2/h7-12,26H,4,6H2,1-2H3 |
| InChIKey | ISLXZLSIAYVGOV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate?
The IUPAC name of methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate (CID 68676394) is methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate.
What is the SMILES notation for methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate?
The canonical SMILES for methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate is COC(=O)CCC#Cc1cc(C(F)(F)F)ccc1NS(=O)(=O)c1ccc2nc(C)oc2c1.
What is the InChIKey of methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate?
The InChIKey is ISLXZLSIAYVGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F3N2O5S/c1-13-25-18-10-8-16(12-19(18)31-13)32(28,29)26-17-9-7-15(21(22,23)24)11-14(17)5-3-4-6-20(27)30-2/h7-12,26H,4,6H2,1-2H3.
What are the key properties of methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate?
methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate has a molecular weight of 466.44 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]pent-4-ynoate is sourced from PubChem (CID 68676394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).