methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate

C7H10O6 — CID 68676483

IUPACmethyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate
SMILESCOC(=O)C1=CC(O)C(O)C(O)O1
InChIInChI=1S/C7H10O6/c1-12-6(10)4-2-3(8)5(9)7(11)13-4/h2-3,5,7-9,11H,1H3
InChIKeyKNJLRCXIQHOXIL-UHFFFAOYSA-N
MW190.15 g/mol
LogP-1.89
Rot. Bonds1

About methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate

methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 68676483) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate.

Molecular Properties

Compound Namemethyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate
PubChem CID68676483
Molecular FormulaC7H10O6
Molecular Weight190.15 g/mol
Exact Mass190.05
IUPAC Namemethyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate
SMILESCOC(=O)C1=CC(O)C(O)C(O)O1
InChIInChI=1S/C7H10O6/c1-12-6(10)4-2-3(8)5(9)7(11)13-4/h2-3,5,7-9,11H,1H3
InChIKeyKNJLRCXIQHOXIL-UHFFFAOYSA-N
XLogP-1.89
TPSA96.22 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.15
LogP ≤ 5-1.89
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate?
The IUPAC name of methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate (CID 68676483) is methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate.
What is the SMILES notation for methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate?
The canonical SMILES for methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate is COC(=O)C1=CC(O)C(O)C(O)O1.
What is the InChIKey of methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate?
The InChIKey is KNJLRCXIQHOXIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O6/c1-12-6(10)4-2-3(8)5(9)7(11)13-4/h2-3,5,7-9,11H,1H3.
What are the key properties of methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate?
methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate has a molecular weight of 190.15 g/mol, XLogP of -1.89, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylate is sourced from PubChem (CID 68676483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).