About 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine
2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine (PubChem CID 68676687) has the molecular formula C19H16FN5O2S
and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine |
| PubChem CID | 68676687 |
| Molecular Formula | C19H16FN5O2S |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine |
| SMILES | Cc1cn2c(-c3ccnc(S(C)(=O)=O)n3)c(-c3ccc(F)cc3)nc2c(C)n1 |
| InChI | InChI=1S/C19H16FN5O2S/c1-11-10-25-17(15-8-9-21-19(23-15)28(3,26)27)16(24-18(25)12(2)22-11)13-4-6-14(20)7-5-13/h4-10H,1-3H3 |
| InChIKey | XIEJYTFGUWMLBC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine?
The IUPAC name of 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine (CID 68676687) is 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine.
What is the SMILES notation for 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine?
The canonical SMILES for 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine is Cc1cn2c(-c3ccnc(S(C)(=O)=O)n3)c(-c3ccc(F)cc3)nc2c(C)n1.
What is the InChIKey of 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine?
The InChIKey is XIEJYTFGUWMLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16FN5O2S/c1-11-10-25-17(15-8-9-21-19(23-15)28(3,26)27)16(24-18(25)12(2)22-11)13-4-6-14(20)7-5-13/h4-10H,1-3H3.
What are the key properties of 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine?
2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine has a molecular weight of 397.44 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-6,8-dimethyl-3-(2-methylsulfonylpyrimidin-4-yl)imidazo[1,2-a]pyrazine is sourced from PubChem (CID 68676687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).