About (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine
(E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine (PubChem CID 6867718) has the molecular formula C16H17Cl2N4+
and a molecular weight of 336.25 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine.
Molecular Properties
| Compound Name | (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine |
| PubChem CID | 6867718 |
| Molecular Formula | C16H17Cl2N4+ |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine |
| SMILES | Clc1ccc(/C=N/N2CCN(c3cccc[nH+]3)CC2)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N4/c17-14-5-4-13(11-15(14)18)12-20-22-9-7-21(8-10-22)16-3-1-2-6-19-16/h1-6,11-12H,7-10H2/p+1/b20-12+ |
| InChIKey | NLVGLOALQAMWFW-UDWIEESQSA-O |
| XLogP | 2.96 |
| TPSA | 32.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine?
The IUPAC name of (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine (CID 6867718) is (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine.
What is the SMILES notation for (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine?
The canonical SMILES for (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine is Clc1ccc(/C=N/N2CCN(c3cccc[nH+]3)CC2)cc1Cl.
What is the InChIKey of (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine?
The InChIKey is NLVGLOALQAMWFW-UDWIEESQSA-O. The full InChI is InChI=1S/C16H16Cl2N4/c17-14-5-4-13(11-15(14)18)12-20-22-9-7-21(8-10-22)16-3-1-2-6-19-16/h1-6,11-12H,7-10H2/p+1/b20-12+.
What are the key properties of (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine?
(E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine has a molecular weight of 336.25 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(3,4-dichlorophenyl)-N-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanimine is sourced from PubChem (CID 6867718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).