About 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid
4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid (PubChem CID 68677412) has the molecular formula C21H19F3N2O4S
and a molecular weight of 452.45 g/mol. Its IUPAC name is 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid.
Molecular Properties
| Compound Name | 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid |
| PubChem CID | 68677412 |
| Molecular Formula | C21H19F3N2O4S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1cc2cc(C(F)(F)F)ccc2n1S(=O)(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C21H19F3N2O4S/c22-21(23,24)15-4-7-19-14(10-15)11-16(2-1-3-20(27)28)26(19)31(29,30)17-5-6-18-13(12-17)8-9-25-18/h4-7,10-12,25H,1-3,8-9H2,(H,27,28) |
| InChIKey | XWPDUXGEHAQRMX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid?
The IUPAC name of 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid (CID 68677412) is 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid.
What is the SMILES notation for 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid?
The canonical SMILES for 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid is O=C(O)CCCc1cc2cc(C(F)(F)F)ccc2n1S(=O)(=O)c1ccc2c(c1)CCN2.
What is the InChIKey of 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid?
The InChIKey is XWPDUXGEHAQRMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3N2O4S/c22-21(23,24)15-4-7-19-14(10-15)11-16(2-1-3-20(27)28)26(19)31(29,30)17-5-6-18-13(12-17)8-9-25-18/h4-7,10-12,25H,1-3,8-9H2,(H,27,28).
What are the key properties of 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid?
4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid has a molecular weight of 452.45 g/mol, XLogP of 4.27, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,3-dihydro-1H-indol-5-ylsulfonyl)-5-(trifluoromethyl)indol-2-yl]butanoic acid is sourced from PubChem (CID 68677412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).