C24H29FO4S — CID 68677421
(Z)-7-[(1R,2S,3R)-2-[3-(1-benzothiophen-2-yl)-2-fluoro-3-hydroxypropyl]-3-hydroxy-5-methylidenecyclopentyl]hept-5-enoic acid (PubChem CID 68677421) has the molecular formula C24H29FO4S and a molecular weight of 432.56 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R)-2-[3-(1-benzothiophen-2-yl)-2-fluoro-3-hydroxypropyl]-3-hydroxy-5-methylidenecyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R)-2-[3-(1-benzothiophen-2-yl)-2-fluoro-3-hydroxypropyl]-3-hydroxy-5-methylidenecyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 68677421 |
| Molecular Formula | C24H29FO4S |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (Z)-7-[(1R,2S,3R)-2-[3-(1-benzothiophen-2-yl)-2-fluoro-3-hydroxypropyl]-3-hydroxy-5-methylidenecyclopentyl]hept-5-enoic acid |
| SMILES | C=C1C[C@@H](O)[C@@H](CC(F)C(O)c2cc3ccccc3s2)[C@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C24H29FO4S/c1-15-12-20(26)18(17(15)9-4-2-3-5-11-23(27)28)14-19(25)24(29)22-13-16-8-6-7-10-21(16)30-22/h2,4,6-8,10,13,17-20,24,26,29H,1,3,5,9,11-12,14H2,(H,27,28)/b4-2-/t17-,18-,19?,20+,24?/m0/s1 |
| InChIKey | AKOGQFBJWQEYSP-FJAJZDINSA-N |
| XLogP | 5.42 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|