About methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate
methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate (PubChem CID 68677816) has the molecular formula C22H19F3N2O5S
and a molecular weight of 480.46 g/mol. Its IUPAC name is methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate.
Molecular Properties
| Compound Name | methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate |
| PubChem CID | 68677816 |
| Molecular Formula | C22H19F3N2O5S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate |
| SMILES | COC(=O)CCCC#Cc1cc(C(F)(F)F)ccc1NS(=O)(=O)c1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C22H19F3N2O5S/c1-14-26-19-11-9-17(13-20(19)32-14)33(29,30)27-18-10-8-16(22(23,24)25)12-15(18)6-4-3-5-7-21(28)31-2/h8-13,27H,3,5,7H2,1-2H3 |
| InChIKey | AASFYOYILZIDSB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate?
The IUPAC name of methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate (CID 68677816) is methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate.
What is the SMILES notation for methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate?
The canonical SMILES for methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate is COC(=O)CCCC#Cc1cc(C(F)(F)F)ccc1NS(=O)(=O)c1ccc2nc(C)oc2c1.
What is the InChIKey of methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate?
The InChIKey is AASFYOYILZIDSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3N2O5S/c1-14-26-19-11-9-17(13-20(19)32-14)33(29,30)27-18-10-8-16(22(23,24)25)12-15(18)6-4-3-5-7-21(28)31-2/h8-13,27H,3,5,7H2,1-2H3.
What are the key properties of methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate?
methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate has a molecular weight of 480.46 g/mol, XLogP of 4.65, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[2-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]-5-(trifluoromethyl)phenyl]hex-5-ynoate is sourced from PubChem (CID 68677816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).