About 1-oxothiane-4-carboxylic acid
1-oxothiane-4-carboxylic acid (PubChem CID 68677829) has the molecular formula C6H10O3S
and a molecular weight of 162.21 g/mol. Its IUPAC name is 1-oxothiane-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-oxothiane-4-carboxylic acid |
| PubChem CID | 68677829 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1-oxothiane-4-carboxylic acid |
| SMILES | O=C(O)C1CCS(=O)CC1 |
| InChI | InChI=1S/C6H10O3S/c7-6(8)5-1-3-10(9)4-2-5/h5H,1-4H2,(H,7,8) |
| InChIKey | GMNLDRKSMPFJRH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxothiane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxothiane-4-carboxylic acid?
The IUPAC name of 1-oxothiane-4-carboxylic acid (CID 68677829) is 1-oxothiane-4-carboxylic acid.
What is the SMILES notation for 1-oxothiane-4-carboxylic acid?
The canonical SMILES for 1-oxothiane-4-carboxylic acid is O=C(O)C1CCS(=O)CC1.
What is the InChIKey of 1-oxothiane-4-carboxylic acid?
The InChIKey is GMNLDRKSMPFJRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c7-6(8)5-1-3-10(9)4-2-5/h5H,1-4H2,(H,7,8).
What are the key properties of 1-oxothiane-4-carboxylic acid?
1-oxothiane-4-carboxylic acid has a molecular weight of 162.21 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxothiane-4-carboxylic acid is sourced from PubChem (CID 68677829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).