About [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate
[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 68677889) has the molecular formula C19H26N2O2
and a molecular weight of 314.43 g/mol. Its IUPAC name is [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate |
| PubChem CID | 68677889 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1cccc([C@@H](C)c2nccn2COC(=O)C(C)(C)C)c1C |
| InChI | InChI=1S/C19H26N2O2/c1-13-8-7-9-16(14(13)2)15(3)17-20-10-11-21(17)12-23-18(22)19(4,5)6/h7-11,15H,12H2,1-6H3/t15-/m1/s1 |
| InChIKey | ZXKQUEBGDVKHLD-OAHLLOKOSA-N |
| XLogP | 4.20 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate?
The IUPAC name of [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate (CID 68677889) is [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate.
What is the SMILES notation for [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate?
The canonical SMILES for [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate is Cc1cccc([C@@H](C)c2nccn2COC(=O)C(C)(C)C)c1C.
What is the InChIKey of [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate?
The InChIKey is ZXKQUEBGDVKHLD-OAHLLOKOSA-N. The full InChI is InChI=1S/C19H26N2O2/c1-13-8-7-9-16(14(13)2)15(3)17-20-10-11-21(17)12-23-18(22)19(4,5)6/h7-11,15H,12H2,1-6H3/t15-/m1/s1.
What are the key properties of [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate?
[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate has a molecular weight of 314.43 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 68677889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).