About (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one
(4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one (PubChem CID 68678118) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one.
Molecular Properties
| Compound Name | (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one |
| PubChem CID | 68678118 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one |
| SMILES | CC(C)C[C@H](O)[C@@H]1OC(C)(C)OCC1=O |
| InChI | InChI=1S/C11H20O4/c1-7(2)5-8(12)10-9(13)6-14-11(3,4)15-10/h7-8,10,12H,5-6H2,1-4H3/t8-,10-/m0/s1 |
| InChIKey | RXTMAYOHJITWLW-WPRPVWTQSA-N |
| XLogP | 1.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one?
The IUPAC name of (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one (CID 68678118) is (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one.
What is the SMILES notation for (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one?
The canonical SMILES for (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one is CC(C)C[C@H](O)[C@@H]1OC(C)(C)OCC1=O.
What is the InChIKey of (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one?
The InChIKey is RXTMAYOHJITWLW-WPRPVWTQSA-N. The full InChI is InChI=1S/C11H20O4/c1-7(2)5-8(12)10-9(13)6-14-11(3,4)15-10/h7-8,10,12H,5-6H2,1-4H3/t8-,10-/m0/s1.
What are the key properties of (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one?
(4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one has a molecular weight of 216.28 g/mol, XLogP of 1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(1S)-1-hydroxy-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-5-one is sourced from PubChem (CID 68678118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).