About 1-benzyl-2,5-dimethylpyrazol-3-one
1-benzyl-2,5-dimethylpyrazol-3-one (PubChem CID 68678187) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-benzyl-2,5-dimethylpyrazol-3-one.
Molecular Properties
| Compound Name | 1-benzyl-2,5-dimethylpyrazol-3-one |
| PubChem CID | 68678187 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-benzyl-2,5-dimethylpyrazol-3-one |
| SMILES | Cc1cc(=O)n(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C12H14N2O/c1-10-8-12(15)13(2)14(10)9-11-6-4-3-5-7-11/h3-8H,9H2,1-2H3 |
| InChIKey | ATTVZEUTYGURQY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-2,5-dimethylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,5-dimethylpyrazol-3-one?
The IUPAC name of 1-benzyl-2,5-dimethylpyrazol-3-one (CID 68678187) is 1-benzyl-2,5-dimethylpyrazol-3-one.
What is the SMILES notation for 1-benzyl-2,5-dimethylpyrazol-3-one?
The canonical SMILES for 1-benzyl-2,5-dimethylpyrazol-3-one is Cc1cc(=O)n(C)n1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2,5-dimethylpyrazol-3-one?
The InChIKey is ATTVZEUTYGURQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-10-8-12(15)13(2)14(10)9-11-6-4-3-5-7-11/h3-8H,9H2,1-2H3.
What are the key properties of 1-benzyl-2,5-dimethylpyrazol-3-one?
1-benzyl-2,5-dimethylpyrazol-3-one has a molecular weight of 202.26 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,5-dimethylpyrazol-3-one is sourced from PubChem (CID 68678187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).