About 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine
9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine (PubChem CID 68678479) has the molecular formula C22H18F3N5O
and a molecular weight of 425.41 g/mol. Its IUPAC name is 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine.
Molecular Properties
| Compound Name | 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine |
| PubChem CID | 68678479 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine |
| SMILES | COc1ccc(-c2ncc3nc(-c4c(F)cc(F)cc4F)n(C4CCCC4)c3n2)cn1 |
| InChI | InChI=1S/C22H18F3N5O/c1-31-18-7-6-12(10-26-18)20-27-11-17-21(29-20)30(14-4-2-3-5-14)22(28-17)19-15(24)8-13(23)9-16(19)25/h6-11,14H,2-5H2,1H3 |
| InChIKey | YUJXKFGCBREUMP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine?
The IUPAC name of 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine (CID 68678479) is 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine.
What is the SMILES notation for 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine?
The canonical SMILES for 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine is COc1ccc(-c2ncc3nc(-c4c(F)cc(F)cc4F)n(C4CCCC4)c3n2)cn1.
What is the InChIKey of 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine?
The InChIKey is YUJXKFGCBREUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F3N5O/c1-31-18-7-6-12(10-26-18)20-27-11-17-21(29-20)30(14-4-2-3-5-14)22(28-17)19-15(24)8-13(23)9-16(19)25/h6-11,14H,2-5H2,1H3.
What are the key properties of 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine?
9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine has a molecular weight of 425.41 g/mol, XLogP of 5.10, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclopentyl-2-(6-methoxy-3-pyridinyl)-8-(2,4,6-trifluorophenyl)purine is sourced from PubChem (CID 68678479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).