About 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide
5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide (PubChem CID 68679658) has the molecular formula C13H11BrN4O2
and a molecular weight of 335.16 g/mol. Its IUPAC name is 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide |
| PubChem CID | 68679658 |
| Molecular Formula | C13H11BrN4O2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide |
| SMILES | Br.Nc1nnc(-c2ccc(Oc3cccnc3)cc2)o1 |
| InChI | InChI=1S/C13H10N4O2.BrH/c14-13-17-16-12(19-13)9-3-5-10(6-4-9)18-11-2-1-7-15-8-11;/h1-8H,(H2,14,17);1H |
| InChIKey | KKKFVFKCMHTRHF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide?
The IUPAC name of 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide (CID 68679658) is 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide.
What is the SMILES notation for 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide?
The canonical SMILES for 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide is Br.Nc1nnc(-c2ccc(Oc3cccnc3)cc2)o1.
What is the InChIKey of 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide?
The InChIKey is KKKFVFKCMHTRHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O2.BrH/c14-13-17-16-12(19-13)9-3-5-10(6-4-9)18-11-2-1-7-15-8-11;/h1-8H,(H2,14,17);1H.
What are the key properties of 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide?
5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide has a molecular weight of 335.16 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-pyridin-3-yloxyphenyl)-1,3,4-oxadiazol-2-amine;hydrobromide is sourced from PubChem (CID 68679658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).