About 1-butyl-4-propyltriazole
1-butyl-4-propyltriazole (PubChem CID 68680561) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-butyl-4-propyltriazole.
Molecular Properties
| Compound Name | 1-butyl-4-propyltriazole |
| PubChem CID | 68680561 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-butyl-4-propyltriazole |
| SMILES | CCCCn1cc(CCC)nn1 |
| InChI | InChI=1S/C9H17N3/c1-3-5-7-12-8-9(6-4-2)10-11-12/h8H,3-7H2,1-2H3 |
| InChIKey | BGKOPXIOKSPKKS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-4-propyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-propyltriazole?
The IUPAC name of 1-butyl-4-propyltriazole (CID 68680561) is 1-butyl-4-propyltriazole.
What is the SMILES notation for 1-butyl-4-propyltriazole?
The canonical SMILES for 1-butyl-4-propyltriazole is CCCCn1cc(CCC)nn1.
What is the InChIKey of 1-butyl-4-propyltriazole?
The InChIKey is BGKOPXIOKSPKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-3-5-7-12-8-9(6-4-2)10-11-12/h8H,3-7H2,1-2H3.
What are the key properties of 1-butyl-4-propyltriazole?
1-butyl-4-propyltriazole has a molecular weight of 167.26 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-propyltriazole is sourced from PubChem (CID 68680561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).