About 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol
4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol (PubChem CID 68680581) has the molecular formula C22H21F3N2O
and a molecular weight of 386.42 g/mol. Its IUPAC name is 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol.
Molecular Properties
| Compound Name | 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol |
| PubChem CID | 68680581 |
| Molecular Formula | C22H21F3N2O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol |
| SMILES | CC1(C)CC(O)(C(F)(F)F)C(Nc2cccc3ncccc23)c2ccccc21 |
| InChI | InChI=1S/C22H21F3N2O/c1-20(2)13-21(28,22(23,24)25)19(14-7-3-4-9-16(14)20)27-18-11-5-10-17-15(18)8-6-12-26-17/h3-12,19,27-28H,13H2,1-2H3 |
| InChIKey | NIKZYQBBZJOLSW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol?
The IUPAC name of 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol (CID 68680581) is 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol.
What is the SMILES notation for 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol?
The canonical SMILES for 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol is CC1(C)CC(O)(C(F)(F)F)C(Nc2cccc3ncccc23)c2ccccc21.
What is the InChIKey of 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol?
The InChIKey is NIKZYQBBZJOLSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F3N2O/c1-20(2)13-21(28,22(23,24)25)19(14-7-3-4-9-16(14)20)27-18-11-5-10-17-15(18)8-6-12-26-17/h3-12,19,27-28H,13H2,1-2H3.
What are the key properties of 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol?
4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol has a molecular weight of 386.42 g/mol, XLogP of 5.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1-(quinolin-5-ylamino)-2-(trifluoromethyl)-1,3-dihydronaphthalen-2-ol is sourced from PubChem (CID 68680581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).