C12H18N4O2 — CID 68681199
(3S)-4-(3,4-diaminophenyl)-3-methylpiperazine-1-carboxylic acid (PubChem CID 68681199) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (3S)-4-(3,4-diaminophenyl)-3-methylpiperazine-1-carboxylic acid.
| Compound Name | (3S)-4-(3,4-diaminophenyl)-3-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68681199 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (3S)-4-(3,4-diaminophenyl)-3-methylpiperazine-1-carboxylic acid |
| SMILES | C[C@H]1CN(C(=O)O)CCN1c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C12H18N4O2/c1-8-7-15(12(17)18)4-5-16(8)9-2-3-10(13)11(14)6-9/h2-3,6,8H,4-5,7,13-14H2,1H3,(H,17,18)/t8-/m0/s1 |
| InChIKey | ADMCAFVMGZGNRJ-QMMMGPOBSA-N |
| XLogP | 1.04 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|