C28H28N4OS — CID 6868278
N-[(E)-[1-[2-(2,4-dimethylphenoxy)ethyl]-2,5-dimethylindol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 6868278) has the molecular formula C28H28N4OS and a molecular weight of 468.63 g/mol. Its IUPAC name is N-[(E)-[1-[2-(2,4-dimethylphenoxy)ethyl]-2,5-dimethylindol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-[1-[2-(2,4-dimethylphenoxy)ethyl]-2,5-dimethylindol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 6868278 |
| Molecular Formula | C28H28N4OS |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-[(E)-[1-[2-(2,4-dimethylphenoxy)ethyl]-2,5-dimethylindol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc(OCCn2c(C)c(/C=N/Nc3nc4ccccc4s3)c3cc(C)ccc32)c(C)c1 |
| InChI | InChI=1S/C28H28N4OS/c1-18-10-12-26(20(3)15-18)33-14-13-32-21(4)23(22-16-19(2)9-11-25(22)32)17-29-31-28-30-24-7-5-6-8-27(24)34-28/h5-12,15-17H,13-14H2,1-4H3,(H,30,31)/b29-17+ |
| InChIKey | YLUQWLIWNWQTLI-STBIYBPSSA-N |
| XLogP | 7.01 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|