About 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene
1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene (PubChem CID 68682793) has the molecular formula C14H12BrFS
and a molecular weight of 311.22 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene |
| PubChem CID | 68682793 |
| Molecular Formula | C14H12BrFS |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene |
| SMILES | Cc1ccc(Sc2ccc(F)cc2Br)c(C)c1 |
| InChI | InChI=1S/C14H12BrFS/c1-9-3-5-13(10(2)7-9)17-14-6-4-11(16)8-12(14)15/h3-8H,1-2H3 |
| InChIKey | HFHVCIXUNJPWAF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene?
The IUPAC name of 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene (CID 68682793) is 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene.
What is the SMILES notation for 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene?
The canonical SMILES for 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene is Cc1ccc(Sc2ccc(F)cc2Br)c(C)c1.
What is the InChIKey of 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene?
The InChIKey is HFHVCIXUNJPWAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrFS/c1-9-3-5-13(10(2)7-9)17-14-6-4-11(16)8-12(14)15/h3-8H,1-2H3.
What are the key properties of 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene?
1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene has a molecular weight of 311.22 g/mol, XLogP of 5.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-4-fluorophenyl)sulfanyl-2,4-dimethylbenzene is sourced from PubChem (CID 68682793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).