C23H21F3N4O4 — CID 68682846
2-[4-[4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid (PubChem CID 68682846) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is 2-[4-[4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 68682846 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-[4-[4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCC(c2ccc(NC(=O)c3nnc(Nc4cc(F)c(F)cc4F)o3)cc2)CC1 |
| InChI | InChI=1S/C23H21F3N4O4/c24-16-10-18(26)19(11-17(16)25)28-23-30-29-22(34-23)21(33)27-15-7-5-14(6-8-15)13-3-1-12(2-4-13)9-20(31)32/h5-8,10-13H,1-4,9H2,(H,27,33)(H,28,30)(H,31,32) |
| InChIKey | GIJLXQXMOBXSII-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|