C17H21FN4O2 — CID 68684423
3-[[(3R,4S)-3-(aminomethyl)-4-hydroxypiperidin-1-yl]methyl]-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 68684423) has the molecular formula C17H21FN4O2 and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-[[(3R,4S)-3-(aminomethyl)-4-hydroxypiperidin-1-yl]methyl]-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | 3-[[(3R,4S)-3-(aminomethyl)-4-hydroxypiperidin-1-yl]methyl]-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 68684423 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-[[(3R,4S)-3-(aminomethyl)-4-hydroxypiperidin-1-yl]methyl]-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | NC[C@@H]1CN(CC2Cn3c(=O)ccc4ncc(F)c2c43)CC[C@@H]1O |
| InChI | InChI=1S/C17H21FN4O2/c18-12-6-20-13-1-2-15(24)22-9-11(16(12)17(13)22)8-21-4-3-14(23)10(5-19)7-21/h1-2,6,10-11,14,23H,3-5,7-9,19H2/t10-,11?,14+/m1/s1 |
| InChIKey | ASIVTYWWWNPFKS-JENJKZFGSA-N |
| XLogP | 0.27 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |