C11H13NO — CID 68684441
3a,4,5,9,9a,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 68684441) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 3a,4,5,9,9a,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | 3a,4,5,9,9a,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 68684441 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3a,4,5,9,9a,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | C1=CCC2C(=C1)NCC1C=COC12 |
| InChI | InChI=1S/C11H13NO/c1-2-4-10-9(3-1)11-8(7-12-10)5-6-13-11/h1-2,4-6,8-9,11-12H,3,7H2 |
| InChIKey | DBWNGMJWCFRJBY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |