C16H19FN4O2 — CID 68684481
3-[[(3S,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 68684481) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is 3-[[(3S,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | 3-[[(3S,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 68684481 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-[[(3S,4R)-4-amino-3-hydroxypiperidin-1-yl]methyl]-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | N[C@@H]1CCN(CC2Cn3c(=O)ccc4ncc(F)c2c43)C[C@@H]1O |
| InChI | InChI=1S/C16H19FN4O2/c17-10-5-19-12-1-2-14(23)21-7-9(15(10)16(12)21)6-20-4-3-11(18)13(22)8-20/h1-2,5,9,11,13,22H,3-4,6-8,18H2/t9?,11-,13+/m1/s1 |
| InChIKey | CMIMOSIWEVEDAP-WPLSFSDESA-N |
| XLogP | 0.03 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |