C13H14N8O — CID 68684893
5-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 68684893) has the molecular formula C13H14N8O and a molecular weight of 298.31 g/mol. Its IUPAC name is 5-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 5-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 68684893 |
| Molecular Formula | C13H14N8O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 5-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CC3CC2CN3)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C13H14N8O/c14-11-17-12(20-6-7-4-8(20)5-15-7)18-13-16-10(19-21(11)13)9-2-1-3-22-9/h1-3,7-8,15H,4-6H2,(H2,14,16,17,18,19) |
| InChIKey | IXEXYITUFSGECS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |