C30H33ClF3N5O4 — CID 68684911
tert-butyl-[1-[4-[3-[3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxopropyl]phenoxy]pyrimidin-2-yl]piperidin-3-yl]carbamic acid (PubChem CID 68684911) has the molecular formula C30H33ClF3N5O4 and a molecular weight of 620.07 g/mol. Its IUPAC name is tert-butyl-[1-[4-[3-[3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxopropyl]phenoxy]pyrimidin-2-yl]piperidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[4-[3-[3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxopropyl]phenoxy]pyrimidin-2-yl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68684911 |
| Molecular Formula | C30H33ClF3N5O4 |
| Molecular Weight | 620.07 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | tert-butyl-[1-[4-[3-[3-[4-chloro-3-(trifluoromethyl)anilino]-3-oxopropyl]phenoxy]pyrimidin-2-yl]piperidin-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCCN(c2nccc(Oc3cccc(CCC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)c3)n2)C1 |
| InChI | InChI=1S/C30H33ClF3N5O4/c1-29(2,3)39(28(41)42)21-7-5-15-38(18-21)27-35-14-13-26(37-27)43-22-8-4-6-19(16-22)9-12-25(40)36-20-10-11-24(31)23(17-20)30(32,33)34/h4,6,8,10-11,13-14,16-17,21H,5,7,9,12,15,18H2,1-3H3,(H,36,40)(H,41,42) |
| InChIKey | ANEYYBXNHVPAES-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.07 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |