About 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid
4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid (PubChem CID 68685096) has the molecular formula C22H24F3NO4S
and a molecular weight of 455.50 g/mol. Its IUPAC name is 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid.
Molecular Properties
| Compound Name | 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid |
| PubChem CID | 68685096 |
| Molecular Formula | C22H24F3NO4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid |
| SMILES | Cc1ccc(Sc2ccc(C(F)(F)F)cc2C2CCNCC2)c(C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H22F3NS.C2H2O4/c1-13-3-5-18(14(2)11-13)25-19-6-4-16(20(21,22)23)12-17(19)15-7-9-24-10-8-15;3-1(4)2(5)6/h3-6,11-12,15,24H,7-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | NKNNGSYCQAWJHC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid?
The IUPAC name of 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid (CID 68685096) is 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid.
What is the SMILES notation for 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid?
The canonical SMILES for 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid is Cc1ccc(Sc2ccc(C(F)(F)F)cc2C2CCNCC2)c(C)c1.O=C(O)C(=O)O.
What is the InChIKey of 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid?
The InChIKey is NKNNGSYCQAWJHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F3NS.C2H2O4/c1-13-3-5-18(14(2)11-13)25-19-6-4-16(20(21,22)23)12-17(19)15-7-9-24-10-8-15;3-1(4)2(5)6/h3-6,11-12,15,24H,7-10H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid?
4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid has a molecular weight of 455.50 g/mol, XLogP of 5.10, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-dimethylphenyl)sulfanyl-5-(trifluoromethyl)phenyl]piperidine;oxalic acid is sourced from PubChem (CID 68685096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).