About 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid
3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid (PubChem CID 68685627) has the molecular formula C12H11NO4
and a molecular weight of 233.22 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid |
| PubChem CID | 68685627 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid |
| SMILES | O=C(O)CC(c1ccc(O)cc1)c1ncco1 |
| InChI | InChI=1S/C12H11NO4/c14-9-3-1-8(2-4-9)10(7-11(15)16)12-13-5-6-17-12/h1-6,10,14H,7H2,(H,15,16) |
| InChIKey | YUIXEMICWRQLQE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid?
The IUPAC name of 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid (CID 68685627) is 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid.
What is the SMILES notation for 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid?
The canonical SMILES for 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid is O=C(O)CC(c1ccc(O)cc1)c1ncco1.
What is the InChIKey of 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid?
The InChIKey is YUIXEMICWRQLQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c14-9-3-1-8(2-4-9)10(7-11(15)16)12-13-5-6-17-12/h1-6,10,14H,7H2,(H,15,16).
What are the key properties of 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid?
3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid has a molecular weight of 233.22 g/mol, XLogP of 1.99, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxyphenyl)-3-(1,3-oxazol-2-yl)propanoic acid is sourced from PubChem (CID 68685627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).