About 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid
3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid (PubChem CID 68686077) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid |
| PubChem CID | 68686077 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid |
| SMILES | CC1(C)NCCN(CCC(=O)O)C1=O |
| InChI | InChI=1S/C9H16N2O3/c1-9(2)8(14)11(6-4-10-9)5-3-7(12)13/h10H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | NRCIGUQEAAPYRN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid?
The IUPAC name of 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid (CID 68686077) is 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid.
What is the SMILES notation for 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid?
The canonical SMILES for 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid is CC1(C)NCCN(CCC(=O)O)C1=O.
What is the InChIKey of 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid?
The InChIKey is NRCIGUQEAAPYRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-9(2)8(14)11(6-4-10-9)5-3-7(12)13/h10H,3-6H2,1-2H3,(H,12,13).
What are the key properties of 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid?
3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid has a molecular weight of 200.24 g/mol, XLogP of -0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethyl-2-oxopiperazin-1-yl)propanoic acid is sourced from PubChem (CID 68686077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).