About 1-ethyl-4-pentyltriazole
1-ethyl-4-pentyltriazole (PubChem CID 68686204) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-ethyl-4-pentyltriazole.
Molecular Properties
| Compound Name | 1-ethyl-4-pentyltriazole |
| PubChem CID | 68686204 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-ethyl-4-pentyltriazole |
| SMILES | CCCCCc1cn(CC)nn1 |
| InChI | InChI=1S/C9H17N3/c1-3-5-6-7-9-8-12(4-2)11-10-9/h8H,3-7H2,1-2H3 |
| InChIKey | MGKHKISSGXOVHN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-pentyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-pentyltriazole?
The IUPAC name of 1-ethyl-4-pentyltriazole (CID 68686204) is 1-ethyl-4-pentyltriazole.
What is the SMILES notation for 1-ethyl-4-pentyltriazole?
The canonical SMILES for 1-ethyl-4-pentyltriazole is CCCCCc1cn(CC)nn1.
What is the InChIKey of 1-ethyl-4-pentyltriazole?
The InChIKey is MGKHKISSGXOVHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-3-5-6-7-9-8-12(4-2)11-10-9/h8H,3-7H2,1-2H3.
What are the key properties of 1-ethyl-4-pentyltriazole?
1-ethyl-4-pentyltriazole has a molecular weight of 167.26 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-pentyltriazole is sourced from PubChem (CID 68686204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).