C13H10ClN7O2S — CID 6868665
4-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 6868665) has the molecular formula C13H10ClN7O2S and a molecular weight of 363.79 g/mol. Its IUPAC name is 4-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6868665 |
| Molecular Formula | C13H10ClN7O2S |
| Molecular Weight | 363.79 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 4-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(5-methyl-1H-pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2/N=C/c2cc([N+](=O)[O-])ccc2Cl)n[nH]1 |
| InChI | InChI=1S/C13H10ClN7O2S/c1-7-4-11(17-16-7)12-18-19-13(24)20(12)15-6-8-5-9(21(22)23)2-3-10(8)14/h2-6H,1H3,(H,16,17)(H,19,24)/b15-6+ |
| InChIKey | AOQJSHAJGFWZGF-GIDUJCDVSA-N |
| XLogP | 3.08 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|