C21H23N5O2 — CID 68687135
1-[(2R)-2-[3-(3-aminophenyl)-1H-1,2,4-triazol-5-yl]piperidin-1-yl]-2-phenoxyethanone (PubChem CID 68687135) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-[(2R)-2-[3-(3-aminophenyl)-1H-1,2,4-triazol-5-yl]piperidin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[(2R)-2-[3-(3-aminophenyl)-1H-1,2,4-triazol-5-yl]piperidin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 68687135 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-[(2R)-2-[3-(3-aminophenyl)-1H-1,2,4-triazol-5-yl]piperidin-1-yl]-2-phenoxyethanone |
| SMILES | Nc1cccc(-c2n[nH]c([C@H]3CCCCN3C(=O)COc3ccccc3)n2)c1 |
| InChI | InChI=1S/C21H23N5O2/c22-16-8-6-7-15(13-16)20-23-21(25-24-20)18-11-4-5-12-26(18)19(27)14-28-17-9-2-1-3-10-17/h1-3,6-10,13,18H,4-5,11-12,14,22H2,(H,23,24,25)/t18-/m1/s1 |
| InChIKey | VRJABBUTSONQCQ-GOSISDBHSA-N |
| XLogP | 3.19 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|