C19H31N3O2 — CID 68687199
tert-butyl-[(1S)-1-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]phenyl]ethyl]carbamic acid (PubChem CID 68687199) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]phenyl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[(1S)-1-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 68687199 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | tert-butyl-[(1S)-1-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]phenyl]ethyl]carbamic acid |
| SMILES | C[C@@H](c1ccc(N2CC[C@@H](N(C)C)C2)cc1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H31N3O2/c1-14(22(18(23)24)19(2,3)4)15-7-9-16(10-8-15)21-12-11-17(13-21)20(5)6/h7-10,14,17H,11-13H2,1-6H3,(H,23,24)/t14-,17+/m0/s1 |
| InChIKey | QLMRPDAFDNMNOB-WMLDXEAASA-N |
| XLogP | 3.67 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|