About 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile
1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile (PubChem CID 68687577) has the molecular formula C12H10N6O
and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile |
| PubChem CID | 68687577 |
| Molecular Formula | C12H10N6O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile |
| SMILES | N#CC1=CN(O)C(n2ccnc2)(n2ccnc2)C=C1 |
| InChI | InChI=1S/C12H10N6O/c13-7-11-1-2-12(18(19)8-11,16-5-3-14-9-16)17-6-4-15-10-17/h1-6,8-10,19H |
| InChIKey | FNPSPAFCIXFLKP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 82.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile?
The IUPAC name of 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile (CID 68687577) is 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile.
What is the SMILES notation for 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile?
The canonical SMILES for 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile is N#CC1=CN(O)C(n2ccnc2)(n2ccnc2)C=C1.
What is the InChIKey of 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile?
The InChIKey is FNPSPAFCIXFLKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N6O/c13-7-11-1-2-12(18(19)8-11,16-5-3-14-9-16)17-6-4-15-10-17/h1-6,8-10,19H.
What are the key properties of 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile?
1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile has a molecular weight of 254.25 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-6,6-di(imidazol-1-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 68687577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).