C27H25N3O4 — CID 68687677
ethyl 3-[3-(1,3-benzodioxol-5-ylamino)-2-(2-phenylethyl)imidazo[1,2-a]pyridin-6-yl]prop-2-enoate (PubChem CID 68687677) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is ethyl 3-[3-(1,3-benzodioxol-5-ylamino)-2-(2-phenylethyl)imidazo[1,2-a]pyridin-6-yl]prop-2-enoate.
| Compound Name | ethyl 3-[3-(1,3-benzodioxol-5-ylamino)-2-(2-phenylethyl)imidazo[1,2-a]pyridin-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 68687677 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | ethyl 3-[3-(1,3-benzodioxol-5-ylamino)-2-(2-phenylethyl)imidazo[1,2-a]pyridin-6-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc2nc(CCc3ccccc3)c(Nc3ccc4c(c3)OCO4)n2c1 |
| InChI | InChI=1S/C27H25N3O4/c1-2-32-26(31)15-10-20-9-14-25-29-22(12-8-19-6-4-3-5-7-19)27(30(25)17-20)28-21-11-13-23-24(16-21)34-18-33-23/h3-7,9-11,13-17,28H,2,8,12,18H2,1H3 |
| InChIKey | YQEBJJPEYLHKQK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|