C25H38N2O5 — CID 68687781
2-(cyclohexylmethyl)-7-[2-(1-methylpyrrolidin-2-yl)ethoxy]-3,4-dihydro-1H-isoquinoline;oxalic acid (PubChem CID 68687781) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-7-[2-(1-methylpyrrolidin-2-yl)ethoxy]-3,4-dihydro-1H-isoquinoline;oxalic acid.
| Compound Name | 2-(cyclohexylmethyl)-7-[2-(1-methylpyrrolidin-2-yl)ethoxy]-3,4-dihydro-1H-isoquinoline;oxalic acid |
|---|---|
| PubChem CID | 68687781 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 2-(cyclohexylmethyl)-7-[2-(1-methylpyrrolidin-2-yl)ethoxy]-3,4-dihydro-1H-isoquinoline;oxalic acid |
| SMILES | CN1CCCC1CCOc1ccc2c(c1)CN(CC1CCCCC1)CC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H36N2O.C2H2O4/c1-24-13-5-8-22(24)12-15-26-23-10-9-20-11-14-25(18-21(20)16-23)17-19-6-3-2-4-7-19;3-1(4)2(5)6/h9-10,16,19,22H,2-8,11-15,17-18H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PJANMEBLBTWYTI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|