C20H14ClN7O2 — CID 68687999
4-(8-chloroimidazo[1,2-a]pyridin-3-yl)-2-[[(1S)-1-(4-nitrophenyl)ethyl]amino]pyrimidine-5-carbonitrile (PubChem CID 68687999) has the molecular formula C20H14ClN7O2 and a molecular weight of 419.83 g/mol. Its IUPAC name is 4-(8-chloroimidazo[1,2-a]pyridin-3-yl)-2-[[(1S)-1-(4-nitrophenyl)ethyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 4-(8-chloroimidazo[1,2-a]pyridin-3-yl)-2-[[(1S)-1-(4-nitrophenyl)ethyl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 68687999 |
| Molecular Formula | C20H14ClN7O2 |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 4-(8-chloroimidazo[1,2-a]pyridin-3-yl)-2-[[(1S)-1-(4-nitrophenyl)ethyl]amino]pyrimidine-5-carbonitrile |
| SMILES | C[C@H](Nc1ncc(C#N)c(-c2cnc3c(Cl)cccn23)n1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H14ClN7O2/c1-12(13-4-6-15(7-5-13)28(29)30)25-20-24-10-14(9-22)18(26-20)17-11-23-19-16(21)3-2-8-27(17)19/h2-8,10-12H,1H3,(H,24,25,26)/t12-/m0/s1 |
| InChIKey | KNKVPDPSUMPMQP-LBPRGKRZSA-N |
| XLogP | 4.40 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|