C31H24ClF2N3O2 — CID 68688110
1-(4-chloro-2,6-dimethylphenyl)-5-[5-(2,4-difluorophenyl)-2-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]-1,3-oxazol-4-yl]pyridin-2-one (PubChem CID 68688110) has the molecular formula C31H24ClF2N3O2 and a molecular weight of 544.00 g/mol. Its IUPAC name is 1-(4-chloro-2,6-dimethylphenyl)-5-[5-(2,4-difluorophenyl)-2-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]-1,3-oxazol-4-yl]pyridin-2-one.
| Compound Name | 1-(4-chloro-2,6-dimethylphenyl)-5-[5-(2,4-difluorophenyl)-2-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]-1,3-oxazol-4-yl]pyridin-2-one |
|---|---|
| PubChem CID | 68688110 |
| Molecular Formula | C31H24ClF2N3O2 |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 1-(4-chloro-2,6-dimethylphenyl)-5-[5-(2,4-difluorophenyl)-2-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]-1,3-oxazol-4-yl]pyridin-2-one |
| SMILES | Cc1cc(Cl)cc(C)c1-n1cc(-c2nc([C@H]3Cc4ccccc4CN3)oc2-c2ccc(F)cc2F)ccc1=O |
| InChI | InChI=1S/C31H24ClF2N3O2/c1-17-11-22(32)12-18(2)29(17)37-16-21(7-10-27(37)38)28-30(24-9-8-23(33)14-25(24)34)39-31(36-28)26-13-19-5-3-4-6-20(19)15-35-26/h3-12,14,16,26,35H,13,15H2,1-2H3/t26-/m1/s1 |
| InChIKey | BYWRQSUBMWHVDY-AREMUKBSSA-N |
| XLogP | 7.09 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |