C27H26FN5O5 — CID 68688792
1-N'-(4-fluorophenyl)-1-N'-[4-[[2-(morpholine-4-carbonylamino)-4-pyridinyl]oxy]phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 68688792) has the molecular formula C27H26FN5O5 and a molecular weight of 519.53 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N'-[4-[[2-(morpholine-4-carbonylamino)-4-pyridinyl]oxy]phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N'-[4-[[2-(morpholine-4-carbonylamino)-4-pyridinyl]oxy]phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 68688792 |
| Molecular Formula | C27H26FN5O5 |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N'-[4-[[2-(morpholine-4-carbonylamino)-4-pyridinyl]oxy]phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N(c2ccc(F)cc2)c2ccc(Oc3ccnc(NC(=O)N4CCOCC4)c3)cc2)CC1 |
| InChI | InChI=1S/C27H26FN5O5/c28-18-1-3-19(4-2-18)33(25(35)27(10-11-27)24(29)34)20-5-7-21(8-6-20)38-22-9-12-30-23(17-22)31-26(36)32-13-15-37-16-14-32/h1-9,12,17H,10-11,13-16H2,(H2,29,34)(H,30,31,36) |
| InChIKey | ADQYZWSBVOPJKQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|