C23H17F3N4 — CID 68689674
5-[5-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-3-pyridinyl]pyridin-2-amine (PubChem CID 68689674) has the molecular formula C23H17F3N4 and a molecular weight of 406.41 g/mol. Its IUPAC name is 5-[5-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-3-pyridinyl]pyridin-2-amine.
| Compound Name | 5-[5-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-3-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 68689674 |
| Molecular Formula | C23H17F3N4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 5-[5-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-3-pyridinyl]pyridin-2-amine |
| SMILES | Cc1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2cncc(-c3ccc(N)nc3)c2)n1 |
| InChI | InChI=1S/C23H17F3N4/c1-14-8-17(15-2-5-20(6-3-15)23(24,25)26)10-21(30-14)19-9-18(11-28-12-19)16-4-7-22(27)29-13-16/h2-13H,1H3,(H2,27,29) |
| InChIKey | DOZSFVNBCNDGEU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |