C21H18F3N3O3 — CID 68689913
2-phenoxy-1-[(2R)-2-[5-(2,4,5-trifluorophenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]ethanone (PubChem CID 68689913) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is 2-phenoxy-1-[(2R)-2-[5-(2,4,5-trifluorophenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-phenoxy-1-[(2R)-2-[5-(2,4,5-trifluorophenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 68689913 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-phenoxy-1-[(2R)-2-[5-(2,4,5-trifluorophenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(COc1ccccc1)N1CCCC[C@@H]1c1noc(-c2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C21H18F3N3O3/c22-15-11-17(24)16(23)10-14(15)21-25-20(26-30-21)18-8-4-5-9-27(18)19(28)12-29-13-6-2-1-3-7-13/h1-3,6-7,10-11,18H,4-5,8-9,12H2/t18-/m1/s1 |
| InChIKey | JWHZIZHOJQOKRT-GOSISDBHSA-N |
| XLogP | 4.29 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|