About 6-amino-4H-1,4-benzothiazin-3-one
6-amino-4H-1,4-benzothiazin-3-one (PubChem CID 686901) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is 6-amino-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 6-amino-4H-1,4-benzothiazin-3-one |
| PubChem CID | 686901 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 6-amino-4H-1,4-benzothiazin-3-one |
| SMILES | Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C8H8N2OS/c9-5-1-2-7-6(3-5)10-8(11)4-12-7/h1-3H,4,9H2,(H,10,11) |
| InChIKey | OTAZYXUGSKFPHN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4H-1,4-benzothiazin-3-one?
The IUPAC name of 6-amino-4H-1,4-benzothiazin-3-one (CID 686901) is 6-amino-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 6-amino-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 6-amino-4H-1,4-benzothiazin-3-one is Nc1ccc2c(c1)NC(=O)CS2.
What is the InChIKey of 6-amino-4H-1,4-benzothiazin-3-one?
The InChIKey is OTAZYXUGSKFPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c9-5-1-2-7-6(3-5)10-8(11)4-12-7/h1-3H,4,9H2,(H,10,11).
What are the key properties of 6-amino-4H-1,4-benzothiazin-3-one?
6-amino-4H-1,4-benzothiazin-3-one has a molecular weight of 180.23 g/mol, XLogP of 1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 686901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).