About N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide
N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide (PubChem CID 68690163) has the molecular formula C24H15Cl2F2NO3
and a molecular weight of 474.29 g/mol. Its IUPAC name is N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide |
| PubChem CID | 68690163 |
| Molecular Formula | C24H15Cl2F2NO3 |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide |
| SMILES | Cc1c(C(=O)c2ccc(Cl)cc2Cl)oc2cc(-c3cccc(NC(=O)C(F)F)c3)ccc12 |
| InChI | InChI=1S/C24H15Cl2F2NO3/c1-12-17-7-5-14(13-3-2-4-16(9-13)29-24(31)23(27)28)10-20(17)32-22(12)21(30)18-8-6-15(25)11-19(18)26/h2-11,23H,1H3,(H,29,31) |
| InChIKey | IITKYNBLNRZVLN-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide?
The IUPAC name of N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide (CID 68690163) is N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide.
What is the SMILES notation for N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide?
The canonical SMILES for N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide is Cc1c(C(=O)c2ccc(Cl)cc2Cl)oc2cc(-c3cccc(NC(=O)C(F)F)c3)ccc12.
What is the InChIKey of N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide?
The InChIKey is IITKYNBLNRZVLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15Cl2F2NO3/c1-12-17-7-5-14(13-3-2-4-16(9-13)29-24(31)23(27)28)10-20(17)32-22(12)21(30)18-8-6-15(25)11-19(18)26/h2-11,23H,1H3,(H,29,31).
What are the key properties of N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide?
N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide has a molecular weight of 474.29 g/mol, XLogP of 7.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[2-(2,4-dichlorobenzoyl)-3-methyl-1-benzofuran-6-yl]phenyl]-2,2-difluoroacetamide is sourced from PubChem (CID 68690163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).