About 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine
1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine (PubChem CID 686902) has the molecular formula C13H10N2O2S
and a molecular weight of 258.30 g/mol. Its IUPAC name is 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine.
Molecular Properties
| Compound Name | 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine |
| PubChem CID | 686902 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C13H10N2O2S/c16-18(17)12-9-5-4-8-11(12)13(15-18)14-10-6-2-1-3-7-10/h1-9H,(H,14,15) |
| InChIKey | PMSHCTAHVFWNET-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine?
The IUPAC name of 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine (CID 686902) is 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine.
What is the SMILES notation for 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine?
The canonical SMILES for 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine is O=S1(=O)N=C(Nc2ccccc2)c2ccccc21.
What is the InChIKey of 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine?
The InChIKey is PMSHCTAHVFWNET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2S/c16-18(17)12-9-5-4-8-11(12)13(15-18)14-10-6-2-1-3-7-10/h1-9H,(H,14,15).
What are the key properties of 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine?
1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine has a molecular weight of 258.30 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-N-phenyl-1,2-benzothiazol-3-amine is sourced from PubChem (CID 686902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).