C29H37N3O3 — CID 68690413
(2S)-N,2-dicyclohexyl-2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]acetamide (PubChem CID 68690413) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is (2S)-N,2-dicyclohexyl-2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]acetamide.
| Compound Name | (2S)-N,2-dicyclohexyl-2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 68690413 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | (2S)-N,2-dicyclohexyl-2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]acetamide |
| SMILES | COc1ccc(-c2nc3ccccc3n2[C@H](C(=O)NC2CCCCC2)C2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C29H37N3O3/c1-34-22-17-18-23(26(19-22)35-2)28-31-24-15-9-10-16-25(24)32(28)27(20-11-5-3-6-12-20)29(33)30-21-13-7-4-8-14-21/h9-10,15-21,27H,3-8,11-14H2,1-2H3,(H,30,33)/t27-/m0/s1 |
| InChIKey | VLEYYMSDWNFSEN-MHZLTWQESA-N |
| XLogP | 6.29 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |