About 5-piperidin-1-yl-1,2,3-benzothiadiazole
5-piperidin-1-yl-1,2,3-benzothiadiazole (PubChem CID 68690452) has the molecular formula C11H13N3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 5-piperidin-1-yl-1,2,3-benzothiadiazole.
Molecular Properties
| Compound Name | 5-piperidin-1-yl-1,2,3-benzothiadiazole |
| PubChem CID | 68690452 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-piperidin-1-yl-1,2,3-benzothiadiazole |
| SMILES | c1cc2snnc2cc1N1CCCCC1 |
| InChI | InChI=1S/C11H13N3S/c1-2-6-14(7-3-1)9-4-5-11-10(8-9)12-13-15-11/h4-5,8H,1-3,6-7H2 |
| InChIKey | JMQVMKXAZWBWGF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-piperidin-1-yl-1,2,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-1-yl-1,2,3-benzothiadiazole?
The IUPAC name of 5-piperidin-1-yl-1,2,3-benzothiadiazole (CID 68690452) is 5-piperidin-1-yl-1,2,3-benzothiadiazole.
What is the SMILES notation for 5-piperidin-1-yl-1,2,3-benzothiadiazole?
The canonical SMILES for 5-piperidin-1-yl-1,2,3-benzothiadiazole is c1cc2snnc2cc1N1CCCCC1.
What is the InChIKey of 5-piperidin-1-yl-1,2,3-benzothiadiazole?
The InChIKey is JMQVMKXAZWBWGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3S/c1-2-6-14(7-3-1)9-4-5-11-10(8-9)12-13-15-11/h4-5,8H,1-3,6-7H2.
What are the key properties of 5-piperidin-1-yl-1,2,3-benzothiadiazole?
5-piperidin-1-yl-1,2,3-benzothiadiazole has a molecular weight of 219.31 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-1-yl-1,2,3-benzothiadiazole is sourced from PubChem (CID 68690452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).